C29H47NO5 — CID 23615030
3,8,10-triethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane (PubChem CID 23615030) has the molecular formula C29H47NO5 and a molecular weight of 489.70 g/mol. Its IUPAC name is 3,8,10-triethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane.
| Compound Name | 3,8,10-triethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 23615030 |
| Molecular Formula | C29H47NO5 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | 3,8,10-triethyl-3,8,10,11-tetramethyl-9-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]-1,5-dioxa-9-azaspiro[5.5]undecane |
| SMILES | CCC1(C)COC2(CC(C)(CC)N(OC(C)c3ccc(OCC4CO4)cc3)C(C)(CC)C2C)OC1 |
| InChI | InChI=1S/C29H47NO5/c1-9-26(6)19-33-29(34-20-26)18-27(7,10-2)30(28(8,11-3)22(29)5)35-21(4)23-12-14-24(15-13-23)31-16-25-17-32-25/h12-15,21-22,25H,9-11,16-20H2,1-8H3 |
| InChIKey | BKGUKKDFUYNASS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|