C26H39NO5 — CID 58759296
2',2',6',6'-tetramethyl-1'-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] (PubChem CID 58759296) has the molecular formula C26H39NO5 and a molecular weight of 445.60 g/mol. Its IUPAC name is 2',2',6',6'-tetramethyl-1'-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine].
| Compound Name | 2',2',6',6'-tetramethyl-1'-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
|---|---|
| PubChem CID | 58759296 |
| Molecular Formula | C26H39NO5 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 2',2',6',6'-tetramethyl-1'-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,4'-piperidine] |
| SMILES | CC(ON1C(C)(C)CC2(CC1(C)C)OC1CCCCC1O2)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C26H39NO5/c1-18(19-10-12-20(13-11-19)28-14-21-15-29-21)32-27-24(2,3)16-26(17-25(27,4)5)30-22-8-6-7-9-23(22)31-26/h10-13,18,21-23H,6-9,14-17H2,1-5H3 |
| InChIKey | GGUKIRVYPLJWPS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|