C38H67NO5 — CID 23615011
2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine (PubChem CID 23615011) has the molecular formula C38H67NO5 and a molecular weight of 617.96 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine.
| Compound Name | 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine |
|---|---|
| PubChem CID | 23615011 |
| Molecular Formula | C38H67NO5 |
| Molecular Weight | 617.96 g/mol |
| Exact Mass | 617.50 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-[1-[4-(oxiran-2-ylmethoxy)phenyl]ethoxy]piperidine |
| SMILES | CCCCCCCCOC1(OCCCCCCCC)CC(C)(C)N(OC(C)c2ccc(OCC3CO3)cc2)C(CC)(CC)C1 |
| InChI | InChI=1S/C38H67NO5/c1-8-12-14-16-18-20-26-42-38(43-27-21-19-17-15-13-9-2)30-36(6,7)39(37(10-3,11-4)31-38)44-32(5)33-22-24-34(25-23-33)40-28-35-29-41-35/h22-25,32,35H,8-21,26-31H2,1-7H3 |
| InChIKey | JHRXNMUMBVGIQX-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 52.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.96 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|