C35H63NO3 — CID 91564852
2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-(2-phenylethoxy)piperidine (PubChem CID 91564852) has the molecular formula C35H63NO3 and a molecular weight of 545.89 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-(2-phenylethoxy)piperidine.
| Compound Name | 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-(2-phenylethoxy)piperidine |
|---|---|
| PubChem CID | 91564852 |
| Molecular Formula | C35H63NO3 |
| Molecular Weight | 545.89 g/mol |
| Exact Mass | 545.48 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-4,4-dioctoxy-1-(2-phenylethoxy)piperidine |
| SMILES | CCCCCCCCOC1(OCCCCCCCC)CC(C)(C)N(OCCc2ccccc2)C(CC)(CC)C1 |
| InChI | InChI=1S/C35H63NO3/c1-7-11-13-15-17-22-27-37-35(38-28-23-18-16-14-12-8-2)30-33(5,6)36(34(9-3,10-4)31-35)39-29-26-32-24-20-19-21-25-32/h19-21,24-25H,7-18,22-23,26-31H2,1-6H3 |
| InChIKey | RIBOXXCMLFFALA-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.89 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|