C25H43NO3 — CID 91323827
2,2-diethyl-6,6-dimethyl-1-(2-phenylethoxy)-4,4-dipropoxypiperidine (PubChem CID 91323827) has the molecular formula C25H43NO3 and a molecular weight of 405.62 g/mol. Its IUPAC name is 2,2-diethyl-6,6-dimethyl-1-(2-phenylethoxy)-4,4-dipropoxypiperidine.
| Compound Name | 2,2-diethyl-6,6-dimethyl-1-(2-phenylethoxy)-4,4-dipropoxypiperidine |
|---|---|
| PubChem CID | 91323827 |
| Molecular Formula | C25H43NO3 |
| Molecular Weight | 405.62 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 2,2-diethyl-6,6-dimethyl-1-(2-phenylethoxy)-4,4-dipropoxypiperidine |
| SMILES | CCCOC1(OCCC)CC(C)(C)N(OCCc2ccccc2)C(CC)(CC)C1 |
| InChI | InChI=1S/C25H43NO3/c1-7-17-27-25(28-18-8-2)20-23(5,6)26(24(9-3,10-4)21-25)29-19-16-22-14-12-11-13-15-22/h11-15H,7-10,16-21H2,1-6H3 |
| InChIKey | IPUBCHVVFNFJJO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|