C24H39NO3 — CID 91235372
7,9-diethyl-3,3,6,7,9-pentamethyl-8-(2-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decane (PubChem CID 91235372) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is 7,9-diethyl-3,3,6,7,9-pentamethyl-8-(2-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decane.
| Compound Name | 7,9-diethyl-3,3,6,7,9-pentamethyl-8-(2-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 91235372 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | 7,9-diethyl-3,3,6,7,9-pentamethyl-8-(2-phenylethoxy)-1,4-dioxa-8-azaspiro[4.5]decane |
| SMILES | CCC1(C)CC2(OCC(C)(C)O2)C(C)C(C)(CC)N1OCCc1ccccc1 |
| InChI | InChI=1S/C24H39NO3/c1-8-22(6)17-24(26-18-21(4,5)28-24)19(3)23(7,9-2)25(22)27-16-15-20-13-11-10-12-14-20/h10-14,19H,8-9,15-18H2,1-7H3 |
| InChIKey | SEMORXQGDRVHGK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |