C44H66N2O6 — CID 91158379
bis[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl] but-2-enedioate (PubChem CID 91158379) has the molecular formula C44H66N2O6 and a molecular weight of 719.02 g/mol. Its IUPAC name is bis[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl] but-2-enedioate.
| Compound Name | bis[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl] but-2-enedioate |
|---|---|
| PubChem CID | 91158379 |
| Molecular Formula | C44H66N2O6 |
| Molecular Weight | 719.02 g/mol |
| Exact Mass | 718.49 |
| IUPAC Name | bis[2,6-diethyl-2,3,6-trimethyl-1-(2-phenylethoxy)piperidin-4-yl] but-2-enedioate |
| SMILES | CCC1(C)CC(OC(=O)C=CC(=O)OC2CC(C)(CC)N(OCCc3ccccc3)C(C)(CC)C2C)C(C)C(C)(CC)N1OCCc1ccccc1 |
| InChI | InChI=1S/C44H66N2O6/c1-11-41(7)31-37(33(5)43(9,13-3)45(41)49-29-27-35-21-17-15-18-22-35)51-39(47)25-26-40(48)52-38-32-42(8,12-2)46(44(10,14-4)34(38)6)50-30-28-36-23-19-16-20-24-36/h15-26,33-34,37-38H,11-14,27-32H2,1-10H3 |
| InChIKey | XDVRCDFQKJJMCI-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.02 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|