C42H68N2O4 — CID 15170011
2,2,6,6-tetramethyl-4-phenylmethoxy-1-[10-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)oxydecoxy]piperidine (PubChem CID 15170011) has the molecular formula C42H68N2O4 and a molecular weight of 665.02 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-phenylmethoxy-1-[10-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)oxydecoxy]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-phenylmethoxy-1-[10-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)oxydecoxy]piperidine |
|---|---|
| PubChem CID | 15170011 |
| Molecular Formula | C42H68N2O4 |
| Molecular Weight | 665.02 g/mol |
| Exact Mass | 664.52 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-phenylmethoxy-1-[10-(2,2,6,6-tetramethyl-4-phenylmethoxypiperidin-1-yl)oxydecoxy]piperidine |
| SMILES | CC1(C)CC(OCc2ccccc2)CC(C)(C)N1OCCCCCCCCCCON1C(C)(C)CC(OCc2ccccc2)CC1(C)C |
| InChI | InChI=1S/C42H68N2O4/c1-39(2)29-37(45-33-35-23-17-15-18-24-35)30-40(3,4)43(39)47-27-21-13-11-9-10-12-14-22-28-48-44-41(5,6)31-38(32-42(44,7)8)46-34-36-25-19-16-20-26-36/h15-20,23-26,37-38H,9-14,21-22,27-34H2,1-8H3 |
| InChIKey | UWRGQWMNLCLHEG-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.02 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|