C11H14O3 — CID 170382479
3-phenylmethoxycyclobutane-1,1-diol (PubChem CID 170382479) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-phenylmethoxycyclobutane-1,1-diol.
| Compound Name | 3-phenylmethoxycyclobutane-1,1-diol |
|---|---|
| PubChem CID | 170382479 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-phenylmethoxycyclobutane-1,1-diol |
| SMILES | OC1(O)CC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C11H14O3/c12-11(13)6-10(7-11)14-8-9-4-2-1-3-5-9/h1-5,10,12-13H,6-8H2 |
| InChIKey | OOXSOOFYJSXJBZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|