C42H44O6 — CID 102432631
(2R,3R,5R,6S)-1-methyl-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol (PubChem CID 102432631) has the molecular formula C42H44O6 and a molecular weight of 644.81 g/mol. Its IUPAC name is (2R,3R,5R,6S)-1-methyl-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (2R,3R,5R,6S)-1-methyl-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102432631 |
| Molecular Formula | C42H44O6 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | (2R,3R,5R,6S)-1-methyl-2,3,4,5,6-pentakis(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CC1(O)[C@H](OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C42H44O6/c1-42(43)40(47-30-35-23-13-5-14-24-35)38(45-28-33-19-9-3-10-20-33)37(44-27-32-17-7-2-8-18-32)39(46-29-34-21-11-4-12-22-34)41(42)48-31-36-25-15-6-16-26-36/h2-26,37-41,43H,27-31H2,1H3/t37?,38-,39?,40+,41-,42?/m1/s1 |
| InChIKey | MKRDZAVFTICOKK-NDGFKGLNSA-N |
| XLogP | 7.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |