C28H30O5 — CID 102374432
(1R,2R,3S,4R,5R)-5-methyl-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 102374432) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-5-methyl-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2R,3S,4R,5R)-5-methyl-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 102374432 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (1R,2R,3S,4R,5R)-5-methyl-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | C[C@@]12OC[C@@H](O1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C28H30O5/c1-28-27(31-19-23-15-9-4-10-16-23)26(30-18-22-13-7-3-8-14-22)25(24(33-28)20-32-28)29-17-21-11-5-2-6-12-21/h2-16,24-27H,17-20H2,1H3/t24-,25-,26+,27-,28-/m1/s1 |
| InChIKey | RSNHMNJGEGTCQV-RKFAPSRVSA-N |
| XLogP | 4.89 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |