C28H30O6 — CID 102472874
[(1R,2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-5-yl]methanol (PubChem CID 102472874) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is [(1R,2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-5-yl]methanol.
| Compound Name | [(1R,2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-5-yl]methanol |
|---|---|
| PubChem CID | 102472874 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [(1R,2R,3S,4S,5R)-2,3,4-tris(phenylmethoxy)-6,8-dioxabicyclo[3.2.1]octan-5-yl]methanol |
| SMILES | OC[C@@]12OC[C@@H](O1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H]2OCc1ccccc1 |
| InChI | InChI=1S/C28H30O6/c29-20-28-27(32-18-23-14-8-3-9-15-23)26(31-17-22-12-6-2-7-13-22)25(24(34-28)19-33-28)30-16-21-10-4-1-5-11-21/h1-15,24-27,29H,16-20H2/t24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | VIJQWUDQWUDSJE-URYJJRPLSA-N |
| XLogP | 3.86 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |