C35H38O6 — CID 134856100
(2R,3S,4R,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 134856100) has the molecular formula C35H38O6 and a molecular weight of 554.68 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2R,3S,4R,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 134856100 |
| Molecular Formula | C35H38O6 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (2R,3S,4R,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | C[C@H]1O[C@](O)(COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H38O6/c1-27-32(38-23-29-16-8-3-9-17-29)33(39-24-30-18-10-4-11-19-30)34(40-25-31-20-12-5-13-21-31)35(36,41-27)26-37-22-28-14-6-2-7-15-28/h2-21,27,32-34,36H,22-26H2,1H3/t27-,32+,33-,34+,35-/m1/s1 |
| InChIKey | AUOLKCQNEFRANA-JNECDHAISA-N |
| XLogP | 6.07 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |