C28H32O6 — CID 11048887
(1R,2R,4S,5S,6R)-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexane-1,2,4-triol (PubChem CID 11048887) has the molecular formula C28H32O6 and a molecular weight of 464.56 g/mol. Its IUPAC name is (1R,2R,4S,5S,6R)-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexane-1,2,4-triol.
| Compound Name | (1R,2R,4S,5S,6R)-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 11048887 |
| Molecular Formula | C28H32O6 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | (1R,2R,4S,5S,6R)-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)cyclohexane-1,2,4-triol |
| SMILES | O[C@@H]1C[C@](O)(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C28H32O6/c29-24-16-28(31,20-32-17-21-10-4-1-5-11-21)27(34-19-23-14-8-3-9-15-23)26(25(24)30)33-18-22-12-6-2-7-13-22/h1-15,24-27,29-31H,16-20H2/t24-,25-,26?,27+,28+/m1/s1 |
| InChIKey | GTZLIDHJGKDVFK-OJTYPVHASA-N |
| XLogP | 3.23 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |