C34H36O6 — CID 14427833
(3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 14427833) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 14427833 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (3S,4R,5R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC1(COCc2ccccc2)OC[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H36O6/c35-34(26-36-21-27-13-5-1-6-14-27)33(39-24-30-19-11-4-12-20-30)32(38-23-29-17-9-3-10-18-29)31(25-40-34)37-22-28-15-7-2-8-16-28/h1-20,31-33,35H,21-26H2/t31-,32-,33+,34?/m1/s1 |
| InChIKey | WYJSUOPAJIPMJR-HBQPKYPGSA-N |
| XLogP | 5.68 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |