C27H30O5 — CID 122386595
(3R,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 122386595) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is (3R,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (3R,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 122386595 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (3R,4S,5S)-2-methyl-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | CC1(O)OCC(OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H30O5/c1-27(28)26(31-19-23-15-9-4-10-16-23)25(30-18-22-13-7-3-8-14-22)24(20-32-27)29-17-21-11-5-2-6-12-21/h2-16,24-26,28H,17-20H2,1H3/t24?,25-,26+,27?/m0/s1 |
| InChIKey | GYRXWZUCMIVSOD-RUZKSTDQSA-N |
| XLogP | 4.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |