C14H18O3 — CID 145031681
(3aR,4R,6aS)-6a-methyl-4-phenylmethoxy-3,3a,4,5-tetrahydro-2H-furo[2,3-b]furan (PubChem CID 145031681) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (3aR,4R,6aS)-6a-methyl-4-phenylmethoxy-3,3a,4,5-tetrahydro-2H-furo[2,3-b]furan.
| Compound Name | (3aR,4R,6aS)-6a-methyl-4-phenylmethoxy-3,3a,4,5-tetrahydro-2H-furo[2,3-b]furan |
|---|---|
| PubChem CID | 145031681 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (3aR,4R,6aS)-6a-methyl-4-phenylmethoxy-3,3a,4,5-tetrahydro-2H-furo[2,3-b]furan |
| SMILES | C[C@@]12OCC[C@@H]1[C@@H](OCc1ccccc1)CO2 |
| InChI | InChI=1S/C14H18O3/c1-14-12(7-8-16-14)13(10-17-14)15-9-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13+,14+/m1/s1 |
| InChIKey | HRBMGPJFJVZXLW-RDBSUJKOSA-N |
| XLogP | 2.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |