C11H13IO2 — CID 165354577
(3R,4R)-3-iodo-4-phenylmethoxyoxolane (PubChem CID 165354577) has the molecular formula C11H13IO2 and a molecular weight of 304.13 g/mol. Its IUPAC name is (3R,4R)-3-iodo-4-phenylmethoxyoxolane.
| Compound Name | (3R,4R)-3-iodo-4-phenylmethoxyoxolane |
|---|---|
| PubChem CID | 165354577 |
| Molecular Formula | C11H13IO2 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | (3R,4R)-3-iodo-4-phenylmethoxyoxolane |
| SMILES | I[C@@H]1COC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C11H13IO2/c12-10-7-13-8-11(10)14-6-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2/t10-,11-/m1/s1 |
| InChIKey | DWXLCGNVZUYQKU-GHMZBOCLSA-N |
| XLogP | 2.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|