About 4-phenylmethoxyoxane
4-phenylmethoxyoxane (PubChem CID 66554133) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-phenylmethoxyoxane.
Molecular Properties
| Compound Name | 4-phenylmethoxyoxane |
| PubChem CID | 66554133 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 4-phenylmethoxyoxane |
| SMILES | c1ccc(COC2CCOCC2)cc1 |
| InChI | InChI=1S/C12H16O2/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12H,6-10H2 |
| InChIKey | GXFJIMLHHUKQJI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylmethoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxyoxane?
The IUPAC name of 4-phenylmethoxyoxane (CID 66554133) is 4-phenylmethoxyoxane.
What is the SMILES notation for 4-phenylmethoxyoxane?
The canonical SMILES for 4-phenylmethoxyoxane is c1ccc(COC2CCOCC2)cc1.
What is the InChIKey of 4-phenylmethoxyoxane?
The InChIKey is GXFJIMLHHUKQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12H,6-10H2.
What are the key properties of 4-phenylmethoxyoxane?
4-phenylmethoxyoxane has a molecular weight of 192.26 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxyoxane is sourced from PubChem (CID 66554133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).