C17H26O3 — CID 143382520
ethane;8-phenylmethoxy-1,4-dioxaspiro[4.5]decane (PubChem CID 143382520) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethane;8-phenylmethoxy-1,4-dioxaspiro[4.5]decane.
| Compound Name | ethane;8-phenylmethoxy-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 143382520 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethane;8-phenylmethoxy-1,4-dioxaspiro[4.5]decane |
| SMILES | CC.c1ccc(COC2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C15H20O3.C2H6/c1-2-4-13(5-3-1)12-16-14-6-8-15(9-7-14)17-10-11-18-15;1-2/h1-5,14H,6-12H2;1-2H3 |
| InChIKey | PBFZCRMTOKETID-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |