C22H24O5 — CID 66761730
benzyl 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)benzoate (PubChem CID 66761730) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is benzyl 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)benzoate.
| Compound Name | benzyl 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)benzoate |
|---|---|
| PubChem CID | 66761730 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | benzyl 4-(1,4-dioxaspiro[4.5]decan-8-yloxy)benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(OC2CCC3(CC2)OCCO3)cc1 |
| InChI | InChI=1S/C22H24O5/c23-21(24-16-17-4-2-1-3-5-17)18-6-8-19(9-7-18)27-20-10-12-22(13-11-20)25-14-15-26-22/h1-9,20H,10-16H2 |
| InChIKey | NDQONRKTUFLSFA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |