About benzyl 4-acetylbenzoate
benzyl 4-acetylbenzoate (PubChem CID 590101) has the molecular formula C16H14O3
and a molecular weight of 254.28 g/mol. Its IUPAC name is benzyl 4-acetylbenzoate.
Molecular Properties
| Compound Name | benzyl 4-acetylbenzoate |
| PubChem CID | 590101 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | benzyl 4-acetylbenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O3/c1-12(17)14-7-9-15(10-8-14)16(18)19-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | MJOALHSDHALYGJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 4-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-acetylbenzoate?
The IUPAC name of benzyl 4-acetylbenzoate (CID 590101) is benzyl 4-acetylbenzoate.
What is the SMILES notation for benzyl 4-acetylbenzoate?
The canonical SMILES for benzyl 4-acetylbenzoate is CC(=O)c1ccc(C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-acetylbenzoate?
The InChIKey is MJOALHSDHALYGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c1-12(17)14-7-9-15(10-8-14)16(18)19-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3.
What are the key properties of benzyl 4-acetylbenzoate?
benzyl 4-acetylbenzoate has a molecular weight of 254.28 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-acetylbenzoate is sourced from PubChem (CID 590101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).