About benzyl 4-acetyloxybenzoate
benzyl 4-acetyloxybenzoate (PubChem CID 734064) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is benzyl 4-acetyloxybenzoate.
Molecular Properties
| Compound Name | benzyl 4-acetyloxybenzoate |
| PubChem CID | 734064 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | benzyl 4-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H14O4/c1-12(17)20-15-9-7-14(8-10-15)16(18)19-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | BLFQWFJOXSGTGK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-acetyloxybenzoate?
The IUPAC name of benzyl 4-acetyloxybenzoate (CID 734064) is benzyl 4-acetyloxybenzoate.
What is the SMILES notation for benzyl 4-acetyloxybenzoate?
The canonical SMILES for benzyl 4-acetyloxybenzoate is CC(=O)Oc1ccc(C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-acetyloxybenzoate?
The InChIKey is BLFQWFJOXSGTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4/c1-12(17)20-15-9-7-14(8-10-15)16(18)19-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3.
What are the key properties of benzyl 4-acetyloxybenzoate?
benzyl 4-acetyloxybenzoate has a molecular weight of 270.28 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-acetyloxybenzoate is sourced from PubChem (CID 734064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).