C22H21O6P — CID 163952948
[4-bis(phenylmethoxy)phosphoryloxyphenyl] acetate (PubChem CID 163952948) has the molecular formula C22H21O6P and a molecular weight of 412.38 g/mol. Its IUPAC name is [4-bis(phenylmethoxy)phosphoryloxyphenyl] acetate.
| Compound Name | [4-bis(phenylmethoxy)phosphoryloxyphenyl] acetate |
|---|---|
| PubChem CID | 163952948 |
| Molecular Formula | C22H21O6P |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [4-bis(phenylmethoxy)phosphoryloxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(OP(=O)(OCc2ccccc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21O6P/c1-18(23)27-21-12-14-22(15-13-21)28-29(24,25-16-19-8-4-2-5-9-19)26-17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3 |
| InChIKey | SAXMOIWYYVDFCU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|