C19H23O6P — CID 91289517
1-bis(phenylmethoxy)phosphoryloxypropan-2-yl acetate (PubChem CID 91289517) has the molecular formula C19H23O6P and a molecular weight of 378.36 g/mol. Its IUPAC name is 1-bis(phenylmethoxy)phosphoryloxypropan-2-yl acetate.
| Compound Name | 1-bis(phenylmethoxy)phosphoryloxypropan-2-yl acetate |
|---|---|
| PubChem CID | 91289517 |
| Molecular Formula | C19H23O6P |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 1-bis(phenylmethoxy)phosphoryloxypropan-2-yl acetate |
| SMILES | CC(=O)OC(C)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C19H23O6P/c1-16(25-17(2)20)13-22-26(21,23-14-18-9-5-3-6-10-18)24-15-19-11-7-4-8-12-19/h3-12,16H,13-15H2,1-2H3 |
| InChIKey | GCFVMYVJDQLIRK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|