C38H48O11P2 — CID 158828112
4-bis(phenylmethoxy)phosphoryloxybutyl acetate;dibenzyl 4-hydroxybutyl phosphate (PubChem CID 158828112) has the molecular formula C38H48O11P2 and a molecular weight of 742.74 g/mol. Its IUPAC name is 4-bis(phenylmethoxy)phosphoryloxybutyl acetate;dibenzyl 4-hydroxybutyl phosphate.
| Compound Name | 4-bis(phenylmethoxy)phosphoryloxybutyl acetate;dibenzyl 4-hydroxybutyl phosphate |
|---|---|
| PubChem CID | 158828112 |
| Molecular Formula | C38H48O11P2 |
| Molecular Weight | 742.74 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | 4-bis(phenylmethoxy)phosphoryloxybutyl acetate;dibenzyl 4-hydroxybutyl phosphate |
| SMILES | CC(=O)OCCCCOP(=O)(OCc1ccccc1)OCc1ccccc1.O=P(OCCCCO)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H25O6P.C18H23O5P/c1-18(21)23-14-8-9-15-24-27(22,25-16-19-10-4-2-5-11-19)26-17-20-12-6-3-7-13-20;19-13-7-8-14-21-24(20,22-15-17-9-3-1-4-10-17)23-16-18-11-5-2-6-12-18/h2-7,10-13H,8-9,14-17H2,1H3;1-6,9-12,19H,7-8,13-16H2 |
| InChIKey | IWRWLUMOCDYZLN-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.74 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|