C21H26NO6P — CID 156901166
prop-2-enyl N-[3-bis(phenylmethoxy)phosphoryloxypropyl]carbamate (PubChem CID 156901166) has the molecular formula C21H26NO6P and a molecular weight of 419.41 g/mol. Its IUPAC name is prop-2-enyl N-[3-bis(phenylmethoxy)phosphoryloxypropyl]carbamate.
| Compound Name | prop-2-enyl N-[3-bis(phenylmethoxy)phosphoryloxypropyl]carbamate |
|---|---|
| PubChem CID | 156901166 |
| Molecular Formula | C21H26NO6P |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | prop-2-enyl N-[3-bis(phenylmethoxy)phosphoryloxypropyl]carbamate |
| SMILES | C=CCOC(=O)NCCCOP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H26NO6P/c1-2-15-25-21(23)22-14-9-16-26-29(24,27-17-19-10-5-3-6-11-19)28-18-20-12-7-4-8-13-20/h2-8,10-13H,1,9,14-18H2,(H,22,23) |
| InChIKey | BQNLOQWJXAKYKW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|