C13H20NO5P — CID 89155670
ethoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphinic acid (PubChem CID 89155670) has the molecular formula C13H20NO5P and a molecular weight of 301.28 g/mol. Its IUPAC name is ethoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphinic acid.
| Compound Name | ethoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
|---|---|
| PubChem CID | 89155670 |
| Molecular Formula | C13H20NO5P |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | ethoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H20NO5P/c1-2-19-20(16,17)10-6-9-14-13(15)18-11-12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | MABDZUBNRUNMSI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|