C22H29N2O6P — CID 71121798
ethyl (2S)-2-[[phenoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphoryl]amino]propanoate (PubChem CID 71121798) has the molecular formula C22H29N2O6P and a molecular weight of 448.46 g/mol. Its IUPAC name is ethyl (2S)-2-[[phenoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[phenoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71121798 |
| Molecular Formula | C22H29N2O6P |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | ethyl (2S)-2-[[phenoxy-[3-(phenylmethoxycarbonylamino)propyl]phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CCCNC(=O)OCc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H29N2O6P/c1-3-28-21(25)18(2)24-31(27,30-20-13-8-5-9-14-20)16-10-15-23-22(26)29-17-19-11-6-4-7-12-19/h4-9,11-14,18H,3,10,15-17H2,1-2H3,(H,23,26)(H,24,27)/t18-,31?/m0/s1 |
| InChIKey | DBGZVCJKOIBWIX-AHWGAIPKSA-N |
| XLogP | 4.12 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|