C22H28NO5P — CID 153387978
benzyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphoryl]amino]propanoate (PubChem CID 153387978) has the molecular formula C22H28NO5P and a molecular weight of 417.44 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153387978 |
| Molecular Formula | C22H28NO5P |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | benzyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphoryl]amino]propanoate |
| SMILES | C/C(=C\CCP(=O)(N[C@@H](C)C(=O)OCc1ccccc1)Oc1ccccc1)CO |
| InChI | InChI=1S/C22H28NO5P/c1-18(16-24)10-9-15-29(26,28-21-13-7-4-8-14-21)23-19(2)22(25)27-17-20-11-5-3-6-12-20/h3-8,10-14,19,24H,9,15-17H2,1-2H3,(H,23,26)/b18-10+/t19-,29?/m0/s1 |
| InChIKey | ZSPCSEYMHKSWNW-OZRVKTBRSA-N |
| XLogP | 4.31 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|