C25H36NO4P — CID 166454066
benzyl 2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-(4-methylphenoxy)phosphanyl]amino]propanoate;ethane (PubChem CID 166454066) has the molecular formula C25H36NO4P and a molecular weight of 445.54 g/mol. Its IUPAC name is benzyl 2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-(4-methylphenoxy)phosphanyl]amino]propanoate;ethane.
| Compound Name | benzyl 2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-(4-methylphenoxy)phosphanyl]amino]propanoate;ethane |
|---|---|
| PubChem CID | 166454066 |
| Molecular Formula | C25H36NO4P |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | benzyl 2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-(4-methylphenoxy)phosphanyl]amino]propanoate;ethane |
| SMILES | C/C(=C\CCP(NC(C)C(=O)OCc1ccccc1)Oc1ccc(C)cc1)CO.CC |
| InChI | InChI=1S/C23H30NO4P.C2H6/c1-18-11-13-22(14-12-18)28-29(15-7-8-19(2)16-25)24-20(3)23(26)27-17-21-9-5-4-6-10-21;1-2/h4-6,8-14,20,24-25H,7,15-17H2,1-3H3;1-2H3/b19-8+; |
| InChIKey | MXZUMXLXKWSAPV-BTSUEJIHSA-N |
| XLogP | 5.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|