C25H36NO4P — CID 166454062
benzyl 2-[[4-methylpent-3-enyl-(4-methylphenoxy)phosphoryl]amino]propanoate;ethane (PubChem CID 166454062) has the molecular formula C25H36NO4P and a molecular weight of 445.54 g/mol. Its IUPAC name is benzyl 2-[[4-methylpent-3-enyl-(4-methylphenoxy)phosphoryl]amino]propanoate;ethane.
| Compound Name | benzyl 2-[[4-methylpent-3-enyl-(4-methylphenoxy)phosphoryl]amino]propanoate;ethane |
|---|---|
| PubChem CID | 166454062 |
| Molecular Formula | C25H36NO4P |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | benzyl 2-[[4-methylpent-3-enyl-(4-methylphenoxy)phosphoryl]amino]propanoate;ethane |
| SMILES | CC.CC(C)=CCCP(=O)(NC(C)C(=O)OCc1ccccc1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C23H30NO4P.C2H6/c1-18(2)9-8-16-29(26,28-22-14-12-19(3)13-15-22)24-20(4)23(25)27-17-21-10-6-5-7-11-21;1-2/h5-7,9-15,20H,8,16-17H2,1-4H3,(H,24,26);1-2H3 |
| InChIKey | XGJCXROCSYZWDQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|