C22H17F5NO5P — CID 129234873
benzyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 129234873) has the molecular formula C22H17F5NO5P and a molecular weight of 501.34 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 129234873 |
| Molecular Formula | C22H17F5NO5P |
| Molecular Weight | 501.34 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | benzyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H17F5NO5P/c1-13(22(29)31-12-14-8-4-2-5-9-14)28-34(30,32-15-10-6-3-7-11-15)33-21-19(26)17(24)16(23)18(25)20(21)27/h2-11,13H,12H2,1H3,(H,28,30)/t13-,34?/m0/s1 |
| InChIKey | LSHDZTNPZXYQPP-JKFVLOHPSA-N |
| XLogP | 5.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.34 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|