C21H15F5NO5P — CID 175230884
(2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-(4-phenylphenoxy)phosphoryl]amino]propanoic acid (PubChem CID 175230884) has the molecular formula C21H15F5NO5P and a molecular weight of 487.32 g/mol. Its IUPAC name is (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-(4-phenylphenoxy)phosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-(4-phenylphenoxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 175230884 |
| Molecular Formula | C21H15F5NO5P |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-(4-phenylphenoxy)phosphoryl]amino]propanoic acid |
| SMILES | C[C@H](N[P@](=O)(Oc1ccc(-c2ccccc2)cc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C21H15F5NO5P/c1-11(21(28)29)27-33(30,32-20-18(25)16(23)15(22)17(24)19(20)26)31-14-9-7-13(8-10-14)12-5-3-2-4-6-12/h2-11H,1H3,(H,27,30)(H,28,29)/t11-,33-/m0/s1 |
| InChIKey | GZNWCWFHXFTPJT-YORGCWSKSA-N |
| XLogP | 5.68 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|