C17H15F5NO5P — CID 166746540
(2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoic acid (PubChem CID 166746540) has the molecular formula C17H15F5NO5P and a molecular weight of 439.27 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoic acid |
|---|---|
| PubChem CID | 166746540 |
| Molecular Formula | C17H15F5NO5P |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | (2S)-3-methyl-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]butanoic acid |
| SMILES | CC(C)[C@H](NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C17H15F5NO5P/c1-8(2)15(17(24)25)23-29(26,27-9-6-4-3-5-7-9)28-16-13(21)11(19)10(18)12(20)14(16)22/h3-8,15H,1-2H3,(H,23,26)(H,24,25)/t15-,29?/m0/s1 |
| InChIKey | GTENDGUAEUANOM-AYBWSJBYSA-N |
| XLogP | 4.65 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|