C15H10F6NO5P — CID 174844841
2-[[(4-fluorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid (PubChem CID 174844841) has the molecular formula C15H10F6NO5P and a molecular weight of 429.21 g/mol. Its IUPAC name is 2-[[(4-fluorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid.
| Compound Name | 2-[[(4-fluorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 174844841 |
| Molecular Formula | C15H10F6NO5P |
| Molecular Weight | 429.21 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 2-[[(4-fluorophenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(Oc1ccc(F)cc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C15H10F6NO5P/c1-6(15(23)24)22-28(25,26-8-4-2-7(16)3-5-8)27-14-12(20)10(18)9(17)11(19)13(14)21/h2-6H,1H3,(H,22,25)(H,23,24) |
| InChIKey | XNNCSIXFLJTIOQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|