C20H21F5NO5P — CID 166913911
methyl (2S)-2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 166913911) has the molecular formula C20H21F5NO5P and a molecular weight of 481.35 g/mol. Its IUPAC name is methyl (2S)-2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166913911 |
| Molecular Formula | C20H21F5NO5P |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | methyl (2S)-2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(Oc1ccc(C(C)(C)C)cc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H21F5NO5P/c1-10(19(27)29-5)26-32(28,30-12-8-6-11(7-9-12)20(2,3)4)31-18-16(24)14(22)13(21)15(23)17(18)25/h6-10H,1-5H3,(H,26,28)/t10-,32?/m0/s1 |
| InChIKey | FGRFMWCKTUZMKN-KMUSSGPDSA-N |
| XLogP | 5.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|