C25H31F5NO5P — CID 167528620
2-ethylbutyl (2S)-2-[[(3-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate (PubChem CID 167528620) has the molecular formula C25H31F5NO5P and a molecular weight of 551.49 g/mol. Its IUPAC name is 2-ethylbutyl (2S)-2-[[(3-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | 2-ethylbutyl (2S)-2-[[(3-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 167528620 |
| Molecular Formula | C25H31F5NO5P |
| Molecular Weight | 551.49 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 2-ethylbutyl (2S)-2-[[(3-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCC(CC)COC(=O)[C@H](C)NP(=O)(Oc1cccc(C(C)(C)C)c1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H31F5NO5P/c1-7-15(8-2)13-34-24(32)14(3)31-37(33,35-17-11-9-10-16(12-17)25(4,5)6)36-23-21(29)19(27)18(26)20(28)22(23)30/h9-12,14-15H,7-8,13H2,1-6H3,(H,31,33)/t14-,37?/m0/s1 |
| InChIKey | GHYPQBBEVDCPBP-WWRSBIQQSA-N |
| XLogP | 7.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|