C21H23F5NO5P — CID 166914050
3,3-dimethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 166914050) has the molecular formula C21H23F5NO5P and a molecular weight of 495.38 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166914050 |
| Molecular Formula | C21H23F5NO5P |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F)C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C21H23F5NO5P/c1-12(20(28)30-11-10-21(2,3)4)27-33(29,31-13-8-6-5-7-9-13)32-19-17(25)15(23)14(22)16(24)18(19)26/h5-9,12H,10-11H2,1-4H3,(H,27,29)/t12-,33?/m0/s1 |
| InChIKey | RLBCZSKCJOPUIJ-HHSZUNSFSA-N |
| XLogP | 5.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|