C19H19F5NO5P — CID 86685817
butyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 86685817) has the molecular formula C19H19F5NO5P and a molecular weight of 467.33 g/mol. Its IUPAC name is butyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86685817 |
| Molecular Formula | C19H19F5NO5P |
| Molecular Weight | 467.33 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | butyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H19F5NO5P/c1-3-4-10-28-19(26)11(2)25-31(27,29-12-8-6-5-7-9-12)30-18-16(23)14(21)13(20)15(22)17(18)24/h5-9,11H,3-4,10H2,1-2H3,(H,25,27)/t11-,31?/m0/s1 |
| InChIKey | VPOKMKIJCDIXHN-NWKCHQMOSA-N |
| XLogP | 5.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.33 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|