C29H31F5NO5P — CID 171611732
octyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate (PubChem CID 171611732) has the molecular formula C29H31F5NO5P and a molecular weight of 599.53 g/mol. Its IUPAC name is octyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate.
| Compound Name | octyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 171611732 |
| Molecular Formula | C29H31F5NO5P |
| Molecular Weight | 599.53 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | octyl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCCCCCCCOC(=O)[C@H](Cc1ccccc1)N[P@@](=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H31F5NO5P/c1-2-3-4-5-6-13-18-38-29(36)22(19-20-14-9-7-10-15-20)35-41(37,39-21-16-11-8-12-17-21)40-28-26(33)24(31)23(30)25(32)27(28)34/h7-12,14-17,22H,2-6,13,18-19H2,1H3,(H,35,37)/t22-,41+/m0/s1 |
| InChIKey | VLYSBPQDXOANKJ-HFAXUJHNSA-N |
| XLogP | 8.05 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.53 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|