C38H59N2O9P — CID 168741384
decyl (2S)-2-[[[(2S)-1-decoxy-1-oxopropan-2-yl]oxy-(4-nitrophenoxy)phosphoryl]amino]-3-phenylpropanoate (PubChem CID 168741384) has the molecular formula C38H59N2O9P and a molecular weight of 718.87 g/mol. Its IUPAC name is decyl (2S)-2-[[[(2S)-1-decoxy-1-oxopropan-2-yl]oxy-(4-nitrophenoxy)phosphoryl]amino]-3-phenylpropanoate.
| Compound Name | decyl (2S)-2-[[[(2S)-1-decoxy-1-oxopropan-2-yl]oxy-(4-nitrophenoxy)phosphoryl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 168741384 |
| Molecular Formula | C38H59N2O9P |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | decyl (2S)-2-[[[(2S)-1-decoxy-1-oxopropan-2-yl]oxy-(4-nitrophenoxy)phosphoryl]amino]-3-phenylpropanoate |
| SMILES | CCCCCCCCCCOC(=O)[C@H](Cc1ccccc1)NP(=O)(Oc1ccc([N+](=O)[O-])cc1)O[C@@H](C)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C38H59N2O9P/c1-4-6-8-10-12-14-16-21-29-46-37(41)32(3)48-50(45,49-35-27-25-34(26-28-35)40(43)44)39-36(31-33-23-19-18-20-24-33)38(42)47-30-22-17-15-13-11-9-7-5-2/h18-20,23-28,32,36H,4-17,21-22,29-31H2,1-3H3,(H,39,45)/t32-,36-,50?/m0/s1 |
| InChIKey | QUOKLJKEWWROPL-NXBVHTRZSA-N |
| XLogP | 10.06 |
| TPSA | 143.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|