C29H32N3O11P — CID 166731987
3-[4-[(4-nitrophenoxy)-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]oxyphenyl]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 166731987) has the molecular formula C29H32N3O11P and a molecular weight of 629.56 g/mol. Its IUPAC name is 3-[4-[(4-nitrophenoxy)-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]oxyphenyl]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[4-[(4-nitrophenoxy)-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]oxyphenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 166731987 |
| Molecular Formula | C29H32N3O11P |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | 3-[4-[(4-nitrophenoxy)-[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphoryl]oxyphenyl]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(Oc1ccc(CC(NC(=O)OCc2ccccc2)C(=O)O)cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H32N3O11P/c1-19(2)41-28(35)20(3)31-44(39,43-25-15-11-23(12-16-25)32(37)38)42-24-13-9-21(10-14-24)17-26(27(33)34)30-29(36)40-18-22-7-5-4-6-8-22/h4-16,19-20,26H,17-18H2,1-3H3,(H,30,36)(H,31,39)(H,33,34) |
| InChIKey | QDQTYIHQGYAMEL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 192.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|