C15H15N2O7P — CID 121344289
2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 121344289) has the molecular formula C15H15N2O7P and a molecular weight of 366.27 g/mol. Its IUPAC name is 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 121344289 |
| Molecular Formula | C15H15N2O7P |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(N[P@](=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C15H15N2O7P/c1-11(15(18)19)16-25(22,23-13-5-3-2-4-6-13)24-14-9-7-12(8-10-14)17(20)21/h2-11H,1H3,(H,16,22)(H,18,19)/t11?,25-/m0/s1 |
| InChIKey | BQBSLSLGCYRCSB-FLRPOARNSA-N |
| XLogP | 3.22 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|