C19H22N3O9P — CID 118966296
[(2S)-2-[bis(4-nitrophenoxy)phosphorylamino]propyl] 2-methylpropanoate (PubChem CID 118966296) has the molecular formula C19H22N3O9P and a molecular weight of 467.37 g/mol. Its IUPAC name is [(2S)-2-[bis(4-nitrophenoxy)phosphorylamino]propyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-[bis(4-nitrophenoxy)phosphorylamino]propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 118966296 |
| Molecular Formula | C19H22N3O9P |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | [(2S)-2-[bis(4-nitrophenoxy)phosphorylamino]propyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H](C)NP(=O)(Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N3O9P/c1-13(2)19(23)29-12-14(3)20-32(28,30-17-8-4-15(5-9-17)21(24)25)31-18-10-6-16(7-11-18)22(26)27/h4-11,13-14H,12H2,1-3H3,(H,20,28)/t14-/m0/s1 |
| InChIKey | RYBSQSLOJQVRKB-AWEZNQCLSA-N |
| XLogP | 4.25 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|