C19H24N3O7P — CID 175315294
2-(dimethylamino)ethyl 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 175315294) has the molecular formula C19H24N3O7P and a molecular weight of 437.39 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-(dimethylamino)ethyl 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 175315294 |
| Molecular Formula | C19H24N3O7P |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OCCN(C)C |
| InChI | InChI=1S/C19H24N3O7P/c1-15(19(23)27-14-13-21(2)3)20-30(26,28-17-7-5-4-6-8-17)29-18-11-9-16(10-12-18)22(24)25/h4-12,15H,13-14H2,1-3H3,(H,20,26) |
| InChIKey | SDWTXGQTISNMKY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|