C21H25N2O7P — CID 156835329
cyclohexyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835329) has the molecular formula C21H25N2O7P and a molecular weight of 448.41 g/mol. Its IUPAC name is cyclohexyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835329 |
| Molecular Formula | C21H25N2O7P |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | cyclohexyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@](=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C21H25N2O7P/c1-16(21(24)28-18-8-4-2-5-9-18)22-31(27,29-19-10-6-3-7-11-19)30-20-14-12-17(13-15-20)23(25)26/h3,6-7,10-16,18H,2,4-5,8-9H2,1H3,(H,22,27)/t16-,31-/m0/s1 |
| InChIKey | PGRWHMKEPBPWKO-ZYSBOAIWSA-N |
| XLogP | 5.01 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|