C20H24N3O7P — CID 156835605
[(3R)-1-methylpyrrolidin-3-yl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835605) has the molecular formula C20H24N3O7P and a molecular weight of 449.40 g/mol. Its IUPAC name is [(3R)-1-methylpyrrolidin-3-yl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [(3R)-1-methylpyrrolidin-3-yl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835605 |
| Molecular Formula | C20H24N3O7P |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [(3R)-1-methylpyrrolidin-3-yl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)O[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C20H24N3O7P/c1-15(20(24)28-19-12-13-22(2)14-19)21-31(27,29-17-6-4-3-5-7-17)30-18-10-8-16(9-11-18)23(25)26/h3-11,15,19H,12-14H2,1-2H3,(H,21,27)/t15-,19+,31?/m0/s1 |
| InChIKey | ZCBQCCJBLKVLSQ-WFRGNEHQSA-N |
| XLogP | 3.39 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|