C22H24F3N2O7P — CID 156835301
[4-(trifluoromethyl)cyclohexyl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835301) has the molecular formula C22H24F3N2O7P and a molecular weight of 516.41 g/mol. Its IUPAC name is [4-(trifluoromethyl)cyclohexyl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | [4-(trifluoromethyl)cyclohexyl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835301 |
| Molecular Formula | C22H24F3N2O7P |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | [4-(trifluoromethyl)cyclohexyl] (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](N[P@@](=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F3N2O7P/c1-15(21(28)32-18-11-7-16(8-12-18)22(23,24)25)26-35(31,33-19-5-3-2-4-6-19)34-20-13-9-17(10-14-20)27(29)30/h2-6,9-10,13-16,18H,7-8,11-12H2,1H3,(H,26,31)/t15-,16?,18?,35+/m0/s1 |
| InChIKey | IWAAYRSFFQKSJU-GDBZCNNCSA-N |
| XLogP | 5.80 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|