C22H27N2O8P — CID 156835309
(2,2-dimethyloxan-4-yl) 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835309) has the molecular formula C22H27N2O8P and a molecular weight of 478.44 g/mol. Its IUPAC name is (2,2-dimethyloxan-4-yl) 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | (2,2-dimethyloxan-4-yl) 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835309 |
| Molecular Formula | C22H27N2O8P |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (2,2-dimethyloxan-4-yl) 2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OC1CCOC(C)(C)C1 |
| InChI | InChI=1S/C22H27N2O8P/c1-16(21(25)30-20-13-14-29-22(2,3)15-20)23-33(28,31-18-7-5-4-6-8-18)32-19-11-9-17(10-12-19)24(26)27/h4-12,16,20H,13-15H2,1-3H3,(H,23,28) |
| InChIKey | UNDASPBTSNIGEC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|